C10H10N2O3 — CID 125426051
(1R)-3-methyl-4-oxo-1,2-dihydrophthalazine-1-carboxylic acid (PubChem CID 125426051) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is (1R)-3-methyl-4-oxo-1,2-dihydrophthalazine-1-carboxylic acid.
| Compound Name | (1R)-3-methyl-4-oxo-1,2-dihydrophthalazine-1-carboxylic acid |
|---|---|
| PubChem CID | 125426051 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | (1R)-3-methyl-4-oxo-1,2-dihydrophthalazine-1-carboxylic acid |
| SMILES | CN1N[C@@H](C(=O)O)c2ccccc2C1=O |
| InChI | InChI=1S/C10H10N2O3/c1-12-9(13)7-5-3-2-4-6(7)8(11-12)10(14)15/h2-5,8,11H,1H3,(H,14,15)/t8-/m1/s1 |
| InChIKey | FVSQSTJKFDJOAS-MRVPVSSYSA-N |
| XLogP | 0.40 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |