C23H19NO4 — CID 53388428
benzyl N-[(1S,2S)-1-hydroxy-3-oxo-2-phenyl-1H-inden-2-yl]carbamate (PubChem CID 53388428) has the molecular formula C23H19NO4 and a molecular weight of 373.41 g/mol. Its IUPAC name is benzyl N-[(1S,2S)-1-hydroxy-3-oxo-2-phenyl-1H-inden-2-yl]carbamate.
| Compound Name | benzyl N-[(1S,2S)-1-hydroxy-3-oxo-2-phenyl-1H-inden-2-yl]carbamate |
|---|---|
| PubChem CID | 53388428 |
| Molecular Formula | C23H19NO4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | benzyl N-[(1S,2S)-1-hydroxy-3-oxo-2-phenyl-1H-inden-2-yl]carbamate |
| SMILES | O=C(N[C@]1(c2ccccc2)C(=O)c2ccccc2[C@@H]1O)OCc1ccccc1 |
| InChI | InChI=1S/C23H19NO4/c25-20-18-13-7-8-14-19(18)21(26)23(20,17-11-5-2-6-12-17)24-22(27)28-15-16-9-3-1-4-10-16/h1-14,20,25H,15H2,(H,24,27)/t20-,23-/m0/s1 |
| InChIKey | MCLCCUKNZKLJNZ-REWPJTCUSA-N |
| XLogP | 3.74 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |