C11H10BrNO3 — CID 5249228
4-bromo-3-methyl-4-nitro-2,3-dihydronaphthalen-1-one (PubChem CID 5249228) has the molecular formula C11H10BrNO3 and a molecular weight of 284.11 g/mol. Its IUPAC name is 4-bromo-3-methyl-4-nitro-2,3-dihydronaphthalen-1-one.
| Compound Name | 4-bromo-3-methyl-4-nitro-2,3-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 5249228 |
| Molecular Formula | C11H10BrNO3 |
| Molecular Weight | 284.11 g/mol |
| Exact Mass | 282.98 |
| IUPAC Name | 4-bromo-3-methyl-4-nitro-2,3-dihydronaphthalen-1-one |
| SMILES | CC1CC(=O)c2ccccc2C1(Br)[N+](=O)[O-] |
| InChI | InChI=1S/C11H10BrNO3/c1-7-6-10(14)8-4-2-3-5-9(8)11(7,12)13(15)16/h2-5,7H,6H2,1H3 |
| InChIKey | BHGGQLZSWBCMRP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.11 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|