C18H15NO4 — CID 91406663
15-methyl-8-nitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-1-carboxylic acid (PubChem CID 91406663) has the molecular formula C18H15NO4 and a molecular weight of 309.32 g/mol. Its IUPAC name is 15-methyl-8-nitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-1-carboxylic acid.
| Compound Name | 15-methyl-8-nitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-1-carboxylic acid |
|---|---|
| PubChem CID | 91406663 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 15-methyl-8-nitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-1-carboxylic acid |
| SMILES | CC1CC2([N+](=O)[O-])c3ccccc3C1(C(=O)O)c1ccccc12 |
| InChI | InChI=1S/C18H15NO4/c1-11-10-17(19(22)23)12-6-2-4-8-14(12)18(11,16(20)21)15-9-5-3-7-13(15)17/h2-9,11H,10H2,1H3,(H,20,21) |
| InChIKey | VIGJDYXALQIOBE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|