C10H11NO3 — CID 10774145
(1-nitro-2,3-dihydroinden-1-yl)methanol (PubChem CID 10774145) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is (1-nitro-2,3-dihydroinden-1-yl)methanol.
| Compound Name | (1-nitro-2,3-dihydroinden-1-yl)methanol |
|---|---|
| PubChem CID | 10774145 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | (1-nitro-2,3-dihydroinden-1-yl)methanol |
| SMILES | O=[N+]([O-])C1(CO)CCc2ccccc21 |
| InChI | InChI=1S/C10H11NO3/c12-7-10(11(13)14)6-5-8-3-1-2-4-9(8)10/h1-4,12H,5-7H2 |
| InChIKey | LHFWDQNBFGIGGS-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|