C12H9NO4 — CID 791392
(2S,3R)-2-methyl-3-nitrospiro[cyclopropane-1,2'-indene]-1',3'-dione (PubChem CID 791392) has the molecular formula C12H9NO4 and a molecular weight of 231.21 g/mol. Its IUPAC name is (2S,3R)-2-methyl-3-nitrospiro[cyclopropane-1,2'-indene]-1',3'-dione.
| Compound Name | (2S,3R)-2-methyl-3-nitrospiro[cyclopropane-1,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 791392 |
| Molecular Formula | C12H9NO4 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | (2S,3R)-2-methyl-3-nitrospiro[cyclopropane-1,2'-indene]-1',3'-dione |
| SMILES | C[C@@H]1[C@@H]([N+](=O)[O-])C12C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C12H9NO4/c1-6-9(13(16)17)12(6)10(14)7-4-2-3-5-8(7)11(12)15/h2-6,9H,1H3/t6-,9-/m1/s1 |
| InChIKey | ACGFQGQTKRISRU-HZGVNTEJSA-N |
| XLogP | 1.35 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|