C10H5NO5 — CID 6995589
(3R)-3-nitronaphthalene-1,2,4-trione (PubChem CID 6995589) has the molecular formula C10H5NO5 and a molecular weight of 219.15 g/mol. Its IUPAC name is (3R)-3-nitronaphthalene-1,2,4-trione.
| Compound Name | (3R)-3-nitronaphthalene-1,2,4-trione |
|---|---|
| PubChem CID | 6995589 |
| Molecular Formula | C10H5NO5 |
| Molecular Weight | 219.15 g/mol |
| Exact Mass | 219.02 |
| IUPAC Name | (3R)-3-nitronaphthalene-1,2,4-trione |
| SMILES | O=C1C(=O)[C@H]([N+](=O)[O-])C(=O)c2ccccc21 |
| InChI | InChI=1S/C10H5NO5/c12-8-5-3-1-2-4-6(5)9(13)10(14)7(8)11(15)16/h1-4,7H/t7-/m1/s1 |
| InChIKey | GCVWKHIMVRGLFE-SSDOTTSWSA-N |
| XLogP | 0.28 |
| TPSA | 94.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.15 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|