C15H10N2O4 — CID 5050226
3-nitro-1-phenylquinoline-2,4-dione (PubChem CID 5050226) has the molecular formula C15H10N2O4 and a molecular weight of 282.25 g/mol. Its IUPAC name is 3-nitro-1-phenylquinoline-2,4-dione.
| Compound Name | 3-nitro-1-phenylquinoline-2,4-dione |
|---|---|
| PubChem CID | 5050226 |
| Molecular Formula | C15H10N2O4 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 3-nitro-1-phenylquinoline-2,4-dione |
| SMILES | O=C1c2ccccc2N(c2ccccc2)C(=O)C1[N+](=O)[O-] |
| InChI | InChI=1S/C15H10N2O4/c18-14-11-8-4-5-9-12(11)16(10-6-2-1-3-7-10)15(19)13(14)17(20)21/h1-9,13H |
| InChIKey | SQQWMFKVDUWBDX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|