C26H17N5O5 — CID 135033231
1,3-bis(4-nitrophenyl)-5-phenyl-1,3,4-benzotriazepin-2-one (PubChem CID 135033231) has the molecular formula C26H17N5O5 and a molecular weight of 479.45 g/mol. Its IUPAC name is 1,3-bis(4-nitrophenyl)-5-phenyl-1,3,4-benzotriazepin-2-one.
| Compound Name | 1,3-bis(4-nitrophenyl)-5-phenyl-1,3,4-benzotriazepin-2-one |
|---|---|
| PubChem CID | 135033231 |
| Molecular Formula | C26H17N5O5 |
| Molecular Weight | 479.45 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | 1,3-bis(4-nitrophenyl)-5-phenyl-1,3,4-benzotriazepin-2-one |
| SMILES | O=C1N(c2ccc([N+](=O)[O-])cc2)N=C(c2ccccc2)c2ccccc2N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H17N5O5/c32-26-28(19-10-14-21(15-11-19)30(33)34)24-9-5-4-8-23(24)25(18-6-2-1-3-7-18)27-29(26)20-12-16-22(17-13-20)31(35)36/h1-17H |
| InChIKey | PTZYPWFWPIWIHT-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 122.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.45 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|