C25H30N4O3 — CID 69406570
3-cyclodecyl-5-methyl-1-(4-nitrophenyl)-1,3,4-benzotriazepin-2-one (PubChem CID 69406570) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is 3-cyclodecyl-5-methyl-1-(4-nitrophenyl)-1,3,4-benzotriazepin-2-one.
| Compound Name | 3-cyclodecyl-5-methyl-1-(4-nitrophenyl)-1,3,4-benzotriazepin-2-one |
|---|---|
| PubChem CID | 69406570 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 3-cyclodecyl-5-methyl-1-(4-nitrophenyl)-1,3,4-benzotriazepin-2-one |
| SMILES | CC1=NN(C2CCCCCCCCC2)C(=O)N(c2ccc([N+](=O)[O-])cc2)c2ccccc21 |
| InChI | InChI=1S/C25H30N4O3/c1-19-23-13-9-10-14-24(23)27(20-15-17-22(18-16-20)29(31)32)25(30)28(26-19)21-11-7-5-3-2-4-6-8-12-21/h9-10,13-18,21H,2-8,11-12H2,1H3 |
| InChIKey | MAXMBWRMAZPOHZ-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|