C35H42N4O2 — CID 69403684
1-(4-aminophenyl)-5-cyclohexyl-3-[5-(4-methoxyphenyl)-3,3-dimethylcyclohexyl]-1,3,4-benzotriazepin-2-one (PubChem CID 69403684) has the molecular formula C35H42N4O2 and a molecular weight of 550.75 g/mol. Its IUPAC name is 1-(4-aminophenyl)-5-cyclohexyl-3-[5-(4-methoxyphenyl)-3,3-dimethylcyclohexyl]-1,3,4-benzotriazepin-2-one.
| Compound Name | 1-(4-aminophenyl)-5-cyclohexyl-3-[5-(4-methoxyphenyl)-3,3-dimethylcyclohexyl]-1,3,4-benzotriazepin-2-one |
|---|---|
| PubChem CID | 69403684 |
| Molecular Formula | C35H42N4O2 |
| Molecular Weight | 550.75 g/mol |
| Exact Mass | 550.33 |
| IUPAC Name | 1-(4-aminophenyl)-5-cyclohexyl-3-[5-(4-methoxyphenyl)-3,3-dimethylcyclohexyl]-1,3,4-benzotriazepin-2-one |
| SMILES | COc1ccc(C2CC(N3N=C(C4CCCCC4)c4ccccc4N(c4ccc(N)cc4)C3=O)CC(C)(C)C2)cc1 |
| InChI | InChI=1S/C35H42N4O2/c1-35(2)22-26(24-13-19-30(41-3)20-14-24)21-29(23-35)39-34(40)38(28-17-15-27(36)16-18-28)32-12-8-7-11-31(32)33(37-39)25-9-5-4-6-10-25/h7-8,11-20,25-26,29H,4-6,9-10,21-23,36H2,1-3H3 |
| InChIKey | IEBSVVUUHZUZJF-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 71.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.75 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|