C32H31N5O — CID 69405833
1-(4-aminophenyl)-3-benzyl-5-cyclohexyl-7-pyridin-3-yl-1,3,4-benzotriazepin-2-one (PubChem CID 69405833) has the molecular formula C32H31N5O and a molecular weight of 501.63 g/mol. Its IUPAC name is 1-(4-aminophenyl)-3-benzyl-5-cyclohexyl-7-pyridin-3-yl-1,3,4-benzotriazepin-2-one.
| Compound Name | 1-(4-aminophenyl)-3-benzyl-5-cyclohexyl-7-pyridin-3-yl-1,3,4-benzotriazepin-2-one |
|---|---|
| PubChem CID | 69405833 |
| Molecular Formula | C32H31N5O |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | 1-(4-aminophenyl)-3-benzyl-5-cyclohexyl-7-pyridin-3-yl-1,3,4-benzotriazepin-2-one |
| SMILES | Nc1ccc(N2C(=O)N(Cc3ccccc3)N=C(C3CCCCC3)c3cc(-c4cccnc4)ccc32)cc1 |
| InChI | InChI=1S/C32H31N5O/c33-27-14-16-28(17-15-27)37-30-18-13-25(26-12-7-19-34-21-26)20-29(30)31(24-10-5-2-6-11-24)35-36(32(37)38)22-23-8-3-1-4-9-23/h1,3-4,7-9,12-21,24H,2,5-6,10-11,22,33H2 |
| InChIKey | ZZKQHNBXEKMGLD-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 74.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|