C27H26N4O3 — CID 23625469
3-benzyl-5-cyclohexyl-1-(3-nitrophenyl)-1,3,4-benzotriazepin-2-one (PubChem CID 23625469) has the molecular formula C27H26N4O3 and a molecular weight of 454.53 g/mol. Its IUPAC name is 3-benzyl-5-cyclohexyl-1-(3-nitrophenyl)-1,3,4-benzotriazepin-2-one.
| Compound Name | 3-benzyl-5-cyclohexyl-1-(3-nitrophenyl)-1,3,4-benzotriazepin-2-one |
|---|---|
| PubChem CID | 23625469 |
| Molecular Formula | C27H26N4O3 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 3-benzyl-5-cyclohexyl-1-(3-nitrophenyl)-1,3,4-benzotriazepin-2-one |
| SMILES | O=C1N(Cc2ccccc2)N=C(C2CCCCC2)c2ccccc2N1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H26N4O3/c32-27-29(19-20-10-3-1-4-11-20)28-26(21-12-5-2-6-13-21)24-16-7-8-17-25(24)30(27)22-14-9-15-23(18-22)31(33)34/h1,3-4,7-11,14-18,21H,2,5-6,12-13,19H2 |
| InChIKey | QNUSVSOYBDQVHN-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|