C34H34N4O — CID 69408036
1-(4-aminophenyl)-3-benzyl-5-cyclohexyl-7-(2-methylphenyl)-1,3,4-benzotriazepin-2-one (PubChem CID 69408036) has the molecular formula C34H34N4O and a molecular weight of 514.67 g/mol. Its IUPAC name is 1-(4-aminophenyl)-3-benzyl-5-cyclohexyl-7-(2-methylphenyl)-1,3,4-benzotriazepin-2-one.
| Compound Name | 1-(4-aminophenyl)-3-benzyl-5-cyclohexyl-7-(2-methylphenyl)-1,3,4-benzotriazepin-2-one |
|---|---|
| PubChem CID | 69408036 |
| Molecular Formula | C34H34N4O |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | 1-(4-aminophenyl)-3-benzyl-5-cyclohexyl-7-(2-methylphenyl)-1,3,4-benzotriazepin-2-one |
| SMILES | Cc1ccccc1-c1ccc2c(c1)C(C1CCCCC1)=NN(Cc1ccccc1)C(=O)N2c1ccc(N)cc1 |
| InChI | InChI=1S/C34H34N4O/c1-24-10-8-9-15-30(24)27-16-21-32-31(22-27)33(26-13-6-3-7-14-26)36-37(23-25-11-4-2-5-12-25)34(39)38(32)29-19-17-28(35)18-20-29/h2,4-5,8-12,15-22,26H,3,6-7,13-14,23,35H2,1H3 |
| InChIKey | JKFPGFGTEOOFRU-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|