C36H41N3O4 — CID 69404873
ethyl 3-[4-(5-cyclohexyl-8-methyl-2-oxo-7-phenylmethoxy-3-propan-2-yl-1,3,4-benzotriazepin-1-yl)phenyl]prop-2-enoate (PubChem CID 69404873) has the molecular formula C36H41N3O4 and a molecular weight of 579.74 g/mol. Its IUPAC name is ethyl 3-[4-(5-cyclohexyl-8-methyl-2-oxo-7-phenylmethoxy-3-propan-2-yl-1,3,4-benzotriazepin-1-yl)phenyl]prop-2-enoate.
| Compound Name | ethyl 3-[4-(5-cyclohexyl-8-methyl-2-oxo-7-phenylmethoxy-3-propan-2-yl-1,3,4-benzotriazepin-1-yl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 69404873 |
| Molecular Formula | C36H41N3O4 |
| Molecular Weight | 579.74 g/mol |
| Exact Mass | 579.31 |
| IUPAC Name | ethyl 3-[4-(5-cyclohexyl-8-methyl-2-oxo-7-phenylmethoxy-3-propan-2-yl-1,3,4-benzotriazepin-1-yl)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1ccc(N2C(=O)N(C(C)C)N=C(C3CCCCC3)c3cc(OCc4ccccc4)c(C)cc32)cc1 |
| InChI | InChI=1S/C36H41N3O4/c1-5-42-34(40)21-18-27-16-19-30(20-17-27)38-32-22-26(4)33(43-24-28-12-8-6-9-13-28)23-31(32)35(29-14-10-7-11-15-29)37-39(25(2)3)36(38)41/h6,8-9,12-13,16-23,25,29H,5,7,10-11,14-15,24H2,1-4H3 |
| InChIKey | SETRQZSGTFQESJ-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.74 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|