C35H48N6O5 — CID 23626898
tert-butyl N-[N'-[3-(3-benzyl-5-cyclohexyl-2-oxo-1,3,4-benzotriazepin-1-yl)propyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 23626898) has the molecular formula C35H48N6O5 and a molecular weight of 632.81 g/mol. Its IUPAC name is tert-butyl N-[N'-[3-(3-benzyl-5-cyclohexyl-2-oxo-1,3,4-benzotriazepin-1-yl)propyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N'-[3-(3-benzyl-5-cyclohexyl-2-oxo-1,3,4-benzotriazepin-1-yl)propyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 23626898 |
| Molecular Formula | C35H48N6O5 |
| Molecular Weight | 632.81 g/mol |
| Exact Mass | 632.37 |
| IUPAC Name | tert-butyl N-[N'-[3-(3-benzyl-5-cyclohexyl-2-oxo-1,3,4-benzotriazepin-1-yl)propyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(=NCCCN1C(=O)N(Cc2ccccc2)N=C(C2CCCCC2)c2ccccc21)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H48N6O5/c1-34(2,3)45-31(42)37-30(38-32(43)46-35(4,5)6)36-22-15-23-40-28-21-14-13-20-27(28)29(26-18-11-8-12-19-26)39-41(33(40)44)24-25-16-9-7-10-17-25/h7,9-10,13-14,16-17,20-21,26H,8,11-12,15,18-19,22-24H2,1-6H3,(H2,36,37,38,42,43) |
| InChIKey | UUWRDQOTKBXLLE-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.81 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|