C32H40N4O8 — CID 132608456
9H-fluoren-9-ylmethyl (3S)-3-[3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]propyl]-5-oxo-1,2-oxazolidine-2-carboxylate (PubChem CID 132608456) has the molecular formula C32H40N4O8 and a molecular weight of 608.69 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (3S)-3-[3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]propyl]-5-oxo-1,2-oxazolidine-2-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl (3S)-3-[3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]propyl]-5-oxo-1,2-oxazolidine-2-carboxylate |
|---|---|
| PubChem CID | 132608456 |
| Molecular Formula | C32H40N4O8 |
| Molecular Weight | 608.69 g/mol |
| Exact Mass | 608.28 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (3S)-3-[3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]propyl]-5-oxo-1,2-oxazolidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)NC(=NCCC[C@H]1CC(=O)ON1C(=O)OCC1c2ccccc2-c2ccccc21)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H40N4O8/c1-31(2,3)42-28(38)34-27(35-29(39)43-32(4,5)6)33-17-11-12-20-18-26(37)44-36(20)30(40)41-19-25-23-15-9-7-13-21(23)22-14-8-10-16-24(22)25/h7-10,13-16,20,25H,11-12,17-19H2,1-6H3,(H2,33,34,35,38,39)/t20-/m0/s1 |
| InChIKey | PEEQUAMZSBTCSF-FQEVSTJZSA-N |
| XLogP | 5.65 |
| TPSA | 144.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.69 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|