C31H38N4O8 — CID 177491661
(3S,4R)-1-[(Z)-N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-4-(9H-fluoren-9-ylmethoxycarbonylamino)pyrrolidine-3-carboxylic acid (PubChem CID 177491661) has the molecular formula C31H38N4O8 and a molecular weight of 594.67 g/mol. Its IUPAC name is (3S,4R)-1-[(Z)-N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-4-(9H-fluoren-9-ylmethoxycarbonylamino)pyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4R)-1-[(Z)-N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-4-(9H-fluoren-9-ylmethoxycarbonylamino)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 177491661 |
| Molecular Formula | C31H38N4O8 |
| Molecular Weight | 594.67 g/mol |
| Exact Mass | 594.27 |
| IUPAC Name | (3S,4R)-1-[(Z)-N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-4-(9H-fluoren-9-ylmethoxycarbonylamino)pyrrolidine-3-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)/N=C(/NC(=O)OC(C)(C)C)N1C[C@H](NC(=O)OCC2c3ccccc3-c3ccccc32)[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C31H38N4O8/c1-30(2,3)42-28(39)33-26(34-29(40)43-31(4,5)6)35-15-22(25(36)37)24(16-35)32-27(38)41-17-23-20-13-9-7-11-18(20)19-12-8-10-14-21(19)23/h7-14,22-24H,15-17H2,1-6H3,(H,32,38)(H,36,37)(H,33,34,39,40)/t22-,24-/m0/s1 |
| InChIKey | VVMCIPHVTCRHIH-UPVQGACJSA-N |
| XLogP | 4.73 |
| TPSA | 155.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.67 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|