C31H42N4O7 — CID 22958055
9H-fluoren-9-ylmethyl N-[5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-1-hydroxypentan-2-yl]carbamate (PubChem CID 22958055) has the molecular formula C31H42N4O7 and a molecular weight of 582.70 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-1-hydroxypentan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-1-hydroxypentan-2-yl]carbamate |
|---|---|
| PubChem CID | 22958055 |
| Molecular Formula | C31H42N4O7 |
| Molecular Weight | 582.70 g/mol |
| Exact Mass | 582.31 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-1-hydroxypentan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(=NCCCC(CO)NC(=O)OCC1c2ccccc2-c2ccccc21)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H42N4O7/c1-30(2,3)41-28(38)34-26(35-29(39)42-31(4,5)6)32-17-11-12-20(18-36)33-27(37)40-19-25-23-15-9-7-13-21(23)22-14-8-10-16-24(22)25/h7-10,13-16,20,25,36H,11-12,17-19H2,1-6H3,(H,33,37)(H2,32,34,35,38,39) |
| InChIKey | RRPUQRCZHZIZBJ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 147.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.70 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|