C35H47N3O7 — CID 158011128
tert-butyl 3-[(4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxooctyl]imino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 158011128) has the molecular formula C35H47N3O7 and a molecular weight of 621.78 g/mol. Its IUPAC name is tert-butyl 3-[(4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxooctyl]imino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | tert-butyl 3-[(4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxooctyl]imino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 158011128 |
| Molecular Formula | C35H47N3O7 |
| Molecular Weight | 621.78 g/mol |
| Exact Mass | 621.34 |
| IUPAC Name | tert-butyl 3-[(4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxooctyl]imino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CCCC(=O)[C@H](CCC/N=C(\CC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C35H47N3O7/c1-8-14-29(39)28(19-13-20-36-30(21-31(40)44-34(2,3)4)38-33(42)45-35(5,6)7)37-32(41)43-22-27-25-17-11-9-15-23(25)24-16-10-12-18-26(24)27/h9-12,15-18,27-28H,8,13-14,19-22H2,1-7H3,(H,37,41)(H,36,38,42)/t28-/m0/s1 |
| InChIKey | FGRAPNYRGFANOR-NDEPHWFRSA-N |
| XLogP | 6.70 |
| TPSA | 132.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.78 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|