C31H35N7O2 — CID 91419460
2-[5-cyclohexyl-1-[4-(diaminomethylideneamino)phenyl]-2-oxo-1,3,4-benzotriazepin-3-yl]-N-(2-phenylethyl)acetamide (PubChem CID 91419460) has the molecular formula C31H35N7O2 and a molecular weight of 537.67 g/mol. Its IUPAC name is 2-[5-cyclohexyl-1-[4-(diaminomethylideneamino)phenyl]-2-oxo-1,3,4-benzotriazepin-3-yl]-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[5-cyclohexyl-1-[4-(diaminomethylideneamino)phenyl]-2-oxo-1,3,4-benzotriazepin-3-yl]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 91419460 |
| Molecular Formula | C31H35N7O2 |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 537.29 |
| IUPAC Name | 2-[5-cyclohexyl-1-[4-(diaminomethylideneamino)phenyl]-2-oxo-1,3,4-benzotriazepin-3-yl]-N-(2-phenylethyl)acetamide |
| SMILES | NC(N)=Nc1ccc(N2C(=O)N(CC(=O)NCCc3ccccc3)N=C(C3CCCCC3)c3ccccc32)cc1 |
| InChI | InChI=1S/C31H35N7O2/c32-30(33)35-24-15-17-25(18-16-24)38-27-14-8-7-13-26(27)29(23-11-5-2-6-12-23)36-37(31(38)40)21-28(39)34-20-19-22-9-3-1-4-10-22/h1,3-4,7-10,13-18,23H,2,5-6,11-12,19-21H2,(H,34,39)(H4,32,33,35) |
| InChIKey | RJKONQCDSXLLSQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 129.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|