C42H50N4O2 — CID 143348369
1-[4-[(5S,6R)-5-amino-6-methyl-4-oxooctyl]phenyl]-5-cyclohexyl-3-[(2-phenylcyclohexa-2,4-dien-1-yl)methyl]-1,3,4-benzotriazepin-2-one (PubChem CID 143348369) has the molecular formula C42H50N4O2 and a molecular weight of 642.89 g/mol. Its IUPAC name is 1-[4-[(5S,6R)-5-amino-6-methyl-4-oxooctyl]phenyl]-5-cyclohexyl-3-[(2-phenylcyclohexa-2,4-dien-1-yl)methyl]-1,3,4-benzotriazepin-2-one.
| Compound Name | 1-[4-[(5S,6R)-5-amino-6-methyl-4-oxooctyl]phenyl]-5-cyclohexyl-3-[(2-phenylcyclohexa-2,4-dien-1-yl)methyl]-1,3,4-benzotriazepin-2-one |
|---|---|
| PubChem CID | 143348369 |
| Molecular Formula | C42H50N4O2 |
| Molecular Weight | 642.89 g/mol |
| Exact Mass | 642.39 |
| IUPAC Name | 1-[4-[(5S,6R)-5-amino-6-methyl-4-oxooctyl]phenyl]-5-cyclohexyl-3-[(2-phenylcyclohexa-2,4-dien-1-yl)methyl]-1,3,4-benzotriazepin-2-one |
| SMILES | CC[C@@H](C)[C@H](N)C(=O)CCCc1ccc(N2C(=O)N(CC3CC=CC=C3c3ccccc3)N=C(C3CCCCC3)c3ccccc32)cc1 |
| InChI | InChI=1S/C42H50N4O2/c1-3-30(2)40(43)39(47)24-14-15-31-25-27-35(28-26-31)46-38-23-13-12-22-37(38)41(33-18-8-5-9-19-33)44-45(42(46)48)29-34-20-10-11-21-36(34)32-16-6-4-7-17-32/h4,6-7,10-13,16-17,21-23,25-28,30,33-34,40H,3,5,8-9,14-15,18-20,24,29,43H2,1-2H3/t30-,34?,40+/m1/s1 |
| InChIKey | DHMGPNKURZAWJW-LZDJHMGGSA-N |
| XLogP | 9.47 |
| TPSA | 79.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.89 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |