C30H40N10O2 — CID 78036207
1,2-diamino-1-[4-[5-cyclohexyl-3-[2-(1-methylcyclohexyl)-2-oxoethyl]-2-oxo-1,3,4-benzotriazepin-1-yl]phenyl]-3-hydrazinylideneguanidine (PubChem CID 78036207) has the molecular formula C30H40N10O2 and a molecular weight of 572.72 g/mol. Its IUPAC name is 1,2-diamino-1-[4-[5-cyclohexyl-3-[2-(1-methylcyclohexyl)-2-oxoethyl]-2-oxo-1,3,4-benzotriazepin-1-yl]phenyl]-3-hydrazinylideneguanidine.
| Compound Name | 1,2-diamino-1-[4-[5-cyclohexyl-3-[2-(1-methylcyclohexyl)-2-oxoethyl]-2-oxo-1,3,4-benzotriazepin-1-yl]phenyl]-3-hydrazinylideneguanidine |
|---|---|
| PubChem CID | 78036207 |
| Molecular Formula | C30H40N10O2 |
| Molecular Weight | 572.72 g/mol |
| Exact Mass | 572.33 |
| IUPAC Name | 1,2-diamino-1-[4-[5-cyclohexyl-3-[2-(1-methylcyclohexyl)-2-oxoethyl]-2-oxo-1,3,4-benzotriazepin-1-yl]phenyl]-3-hydrazinylideneguanidine |
| SMILES | CC1(C(=O)CN2N=C(C3CCCCC3)c3ccccc3N(c3ccc(N(N)C(N=NN)=NN)cc3)C2=O)CCCCC1 |
| InChI | InChI=1S/C30H40N10O2/c1-30(18-8-3-9-19-30)26(41)20-38-29(42)39(22-14-16-23(17-15-22)40(33)28(34-31)35-37-32)25-13-7-6-12-24(25)27(36-38)21-10-4-2-5-11-21/h6-7,12-17,21H,2-5,8-11,18-20,31,33H2,1H3,(H2,32,34,35) |
| InChIKey | BIGPRHDEZVFJKJ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 171.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.72 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|