C26H33N5O — CID 53322658
2-[4-[[(3S)-5-cyclohexyl-2-oxo-3-propan-2-yl-3H-1,4-benzodiazepin-1-yl]methyl]phenyl]guanidine (PubChem CID 53322658) has the molecular formula C26H33N5O and a molecular weight of 431.58 g/mol. Its IUPAC name is 2-[4-[[(3S)-5-cyclohexyl-2-oxo-3-propan-2-yl-3H-1,4-benzodiazepin-1-yl]methyl]phenyl]guanidine.
| Compound Name | 2-[4-[[(3S)-5-cyclohexyl-2-oxo-3-propan-2-yl-3H-1,4-benzodiazepin-1-yl]methyl]phenyl]guanidine |
|---|---|
| PubChem CID | 53322658 |
| Molecular Formula | C26H33N5O |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | 2-[4-[[(3S)-5-cyclohexyl-2-oxo-3-propan-2-yl-3H-1,4-benzodiazepin-1-yl]methyl]phenyl]guanidine |
| SMILES | CC(C)[C@@H]1N=C(C2CCCCC2)c2ccccc2N(Cc2ccc(N=C(N)N)cc2)C1=O |
| InChI | InChI=1S/C26H33N5O/c1-17(2)23-25(32)31(16-18-12-14-20(15-13-18)29-26(27)28)22-11-7-6-10-21(22)24(30-23)19-8-4-3-5-9-19/h6-7,10-15,17,19,23H,3-5,8-9,16H2,1-2H3,(H4,27,28,29)/t23-/m0/s1 |
| InChIKey | HNMOCLKMJHPVTD-QHCPKHFHSA-N |
| XLogP | 4.53 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|