C31H44N4O3 — CID 59033265
(3R)-N'-(5-cycloheptyl-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl)-3-(2-methylpropyl)-2,2-bis(prop-2-enyl)butanediamide (PubChem CID 59033265) has the molecular formula C31H44N4O3 and a molecular weight of 520.72 g/mol. Its IUPAC name is (3R)-N'-(5-cycloheptyl-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl)-3-(2-methylpropyl)-2,2-bis(prop-2-enyl)butanediamide.
| Compound Name | (3R)-N'-(5-cycloheptyl-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl)-3-(2-methylpropyl)-2,2-bis(prop-2-enyl)butanediamide |
|---|---|
| PubChem CID | 59033265 |
| Molecular Formula | C31H44N4O3 |
| Molecular Weight | 520.72 g/mol |
| Exact Mass | 520.34 |
| IUPAC Name | (3R)-N'-(5-cycloheptyl-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl)-3-(2-methylpropyl)-2,2-bis(prop-2-enyl)butanediamide |
| SMILES | C=CCC(CC=C)(C(N)=O)[C@@H](CC(C)C)C(=O)NC1N=C(C2CCCCCC2)c2ccccc2N(C)C1=O |
| InChI | InChI=1S/C31H44N4O3/c1-6-18-31(19-7-2,30(32)38)24(20-21(3)4)28(36)34-27-29(37)35(5)25-17-13-12-16-23(25)26(33-27)22-14-10-8-9-11-15-22/h6-7,12-13,16-17,21-22,24,27H,1-2,8-11,14-15,18-20H2,3-5H3,(H2,32,38)(H,34,36)/t24-,27?/m0/s1 |
| InChIKey | PECOQXPVHUQNHD-BXXZMZEQSA-N |
| XLogP | 5.15 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.72 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|