C22H24N4O4 — CID 23625945
5-cyclohexyl-7-hydroxy-3,8-dimethyl-1-(4-nitrophenyl)-1,3,4-benzotriazepin-2-one (PubChem CID 23625945) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is 5-cyclohexyl-7-hydroxy-3,8-dimethyl-1-(4-nitrophenyl)-1,3,4-benzotriazepin-2-one.
| Compound Name | 5-cyclohexyl-7-hydroxy-3,8-dimethyl-1-(4-nitrophenyl)-1,3,4-benzotriazepin-2-one |
|---|---|
| PubChem CID | 23625945 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 5-cyclohexyl-7-hydroxy-3,8-dimethyl-1-(4-nitrophenyl)-1,3,4-benzotriazepin-2-one |
| SMILES | Cc1cc2c(cc1O)C(C1CCCCC1)=NN(C)C(=O)N2c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H24N4O4/c1-14-12-19-18(13-20(14)27)21(15-6-4-3-5-7-15)23-24(2)22(28)25(19)16-8-10-17(11-9-16)26(29)30/h8-13,15,27H,3-7H2,1-2H3 |
| InChIKey | APCGAMYXZKRGOW-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 99.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|