C17H13Cl2N3O3 — CID 141315907
6-(2,4-dichlorophenyl)-4-methyl-3-(4-nitrophenyl)-1,6-dihydropyrimidin-2-one (PubChem CID 141315907) has the molecular formula C17H13Cl2N3O3 and a molecular weight of 378.22 g/mol. Its IUPAC name is 6-(2,4-dichlorophenyl)-4-methyl-3-(4-nitrophenyl)-1,6-dihydropyrimidin-2-one.
| Compound Name | 6-(2,4-dichlorophenyl)-4-methyl-3-(4-nitrophenyl)-1,6-dihydropyrimidin-2-one |
|---|---|
| PubChem CID | 141315907 |
| Molecular Formula | C17H13Cl2N3O3 |
| Molecular Weight | 378.22 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | 6-(2,4-dichlorophenyl)-4-methyl-3-(4-nitrophenyl)-1,6-dihydropyrimidin-2-one |
| SMILES | CC1=CC(c2ccc(Cl)cc2Cl)NC(=O)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H13Cl2N3O3/c1-10-8-16(14-7-2-11(18)9-15(14)19)20-17(23)21(10)12-3-5-13(6-4-12)22(24)25/h2-9,16H,1H3,(H,20,23) |
| InChIKey | BUBWIDNTHUIAPX-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.22 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|