C23H19Cl2N5O3 — CID 135840591
9-(2,4-dichlorophenyl)-6,6-dimethyl-2-(4-nitrophenyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135840591) has the molecular formula C23H19Cl2N5O3 and a molecular weight of 484.34 g/mol. Its IUPAC name is 9-(2,4-dichlorophenyl)-6,6-dimethyl-2-(4-nitrophenyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 9-(2,4-dichlorophenyl)-6,6-dimethyl-2-(4-nitrophenyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135840591 |
| Molecular Formula | C23H19Cl2N5O3 |
| Molecular Weight | 484.34 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | 9-(2,4-dichlorophenyl)-6,6-dimethyl-2-(4-nitrophenyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1nc(-c3ccc([N+](=O)[O-])cc3)nn1C2c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H19Cl2N5O3/c1-23(2)10-17-19(18(31)11-23)20(15-8-5-13(24)9-16(15)25)29-22(26-17)27-21(28-29)12-3-6-14(7-4-12)30(32)33/h3-9,20H,10-11H2,1-2H3,(H,26,27,28) |
| InChIKey | WPXGMFWZBYBOLV-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.34 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|