C24H23ClN4O2 — CID 135765736
2-(3-chlorophenyl)-9-(4-methoxyphenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135765736) has the molecular formula C24H23ClN4O2 and a molecular weight of 434.93 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-9-(4-methoxyphenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 2-(3-chlorophenyl)-9-(4-methoxyphenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135765736 |
| Molecular Formula | C24H23ClN4O2 |
| Molecular Weight | 434.93 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 2-(3-chlorophenyl)-9-(4-methoxyphenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | COc1ccc(C2C3=C(CC(C)(C)CC3=O)Nc3nc(-c4cccc(Cl)c4)nn32)cc1 |
| InChI | InChI=1S/C24H23ClN4O2/c1-24(2)12-18-20(19(30)13-24)21(14-7-9-17(31-3)10-8-14)29-23(26-18)27-22(28-29)15-5-4-6-16(25)11-15/h4-11,21H,12-13H2,1-3H3,(H,26,27,28) |
| InChIKey | JXTNOSQGQCMJAS-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.93 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |