C25H26N4O4 — CID 135704160
9-(2,5-dimethoxyphenyl)-2-(3-hydroxyphenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135704160) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is 9-(2,5-dimethoxyphenyl)-2-(3-hydroxyphenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 9-(2,5-dimethoxyphenyl)-2-(3-hydroxyphenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135704160 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 9-(2,5-dimethoxyphenyl)-2-(3-hydroxyphenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | COc1ccc(OC)c(C2C3=C(CC(C)(C)CC3=O)Nc3nc(-c4cccc(O)c4)nn32)c1 |
| InChI | InChI=1S/C25H26N4O4/c1-25(2)12-18-21(19(31)13-25)22(17-11-16(32-3)8-9-20(17)33-4)29-24(26-18)27-23(28-29)14-6-5-7-15(30)10-14/h5-11,22,30H,12-13H2,1-4H3,(H,26,27,28) |
| InChIKey | PWXMWAOFNDTSOZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |