C26H27N5O3 — CID 135709901
6,6-dimethyl-2-(3-nitrophenyl)-9-(4-propan-2-ylphenyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135709901) has the molecular formula C26H27N5O3 and a molecular weight of 457.53 g/mol. Its IUPAC name is 6,6-dimethyl-2-(3-nitrophenyl)-9-(4-propan-2-ylphenyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 6,6-dimethyl-2-(3-nitrophenyl)-9-(4-propan-2-ylphenyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135709901 |
| Molecular Formula | C26H27N5O3 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 6,6-dimethyl-2-(3-nitrophenyl)-9-(4-propan-2-ylphenyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CC(C)c1ccc(C2C3=C(CC(C)(C)CC3=O)Nc3nc(-c4cccc([N+](=O)[O-])c4)nn32)cc1 |
| InChI | InChI=1S/C26H27N5O3/c1-15(2)16-8-10-17(11-9-16)23-22-20(13-26(3,4)14-21(22)32)27-25-28-24(29-30(23)25)18-6-5-7-19(12-18)31(33)34/h5-12,15,23H,13-14H2,1-4H3,(H,27,28,29) |
| InChIKey | AUGFALVOGKNMBK-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|