C24H21N5O5 — CID 135749420
9-(1,3-benzodioxol-5-yl)-6,6-dimethyl-2-(3-nitrophenyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135749420) has the molecular formula C24H21N5O5 and a molecular weight of 459.46 g/mol. Its IUPAC name is 9-(1,3-benzodioxol-5-yl)-6,6-dimethyl-2-(3-nitrophenyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 9-(1,3-benzodioxol-5-yl)-6,6-dimethyl-2-(3-nitrophenyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135749420 |
| Molecular Formula | C24H21N5O5 |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 9-(1,3-benzodioxol-5-yl)-6,6-dimethyl-2-(3-nitrophenyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1nc(-c3cccc([N+](=O)[O-])c3)nn1C2c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H21N5O5/c1-24(2)10-16-20(17(30)11-24)21(13-6-7-18-19(9-13)34-12-33-18)28-23(25-16)26-22(27-28)14-4-3-5-15(8-14)29(31)32/h3-9,21H,10-12H2,1-2H3,(H,25,26,27) |
| InChIKey | YUDQZRCURVXEET-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 121.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|