C18H18ClN5O3S — CID 4887658
9-(2-chloro-5-nitrophenyl)-6,6-dimethyl-2-methylsulfanyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 4887658) has the molecular formula C18H18ClN5O3S and a molecular weight of 419.89 g/mol. Its IUPAC name is 9-(2-chloro-5-nitrophenyl)-6,6-dimethyl-2-methylsulfanyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 9-(2-chloro-5-nitrophenyl)-6,6-dimethyl-2-methylsulfanyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 4887658 |
| Molecular Formula | C18H18ClN5O3S |
| Molecular Weight | 419.89 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 9-(2-chloro-5-nitrophenyl)-6,6-dimethyl-2-methylsulfanyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CSc1nc2n(n1)C(c1cc([N+](=O)[O-])ccc1Cl)C1=C(CC(C)(C)CC1=O)N2 |
| InChI | InChI=1S/C18H18ClN5O3S/c1-18(2)7-12-14(13(25)8-18)15(23-16(20-12)21-17(22-23)28-3)10-6-9(24(26)27)4-5-11(10)19/h4-6,15H,7-8H2,1-3H3,(H,20,21,22) |
| InChIKey | SAGOWZACXWLYDQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.89 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|