C21H24Cl2N4OS — CID 136806775
(9R)-2-butylsulfanyl-9-(2,4-dichlorophenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 136806775) has the molecular formula C21H24Cl2N4OS and a molecular weight of 451.42 g/mol. Its IUPAC name is (9R)-2-butylsulfanyl-9-(2,4-dichlorophenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (9R)-2-butylsulfanyl-9-(2,4-dichlorophenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 136806775 |
| Molecular Formula | C21H24Cl2N4OS |
| Molecular Weight | 451.42 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | (9R)-2-butylsulfanyl-9-(2,4-dichlorophenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CCCCSc1nc2n(n1)[C@@H](c1ccc(Cl)cc1Cl)C1=C(CC(C)(C)CC1=O)N2 |
| InChI | InChI=1S/C21H24Cl2N4OS/c1-4-5-8-29-20-25-19-24-15-10-21(2,3)11-16(28)17(15)18(27(19)26-20)13-7-6-12(22)9-14(13)23/h6-7,9,18H,4-5,8,10-11H2,1-3H3,(H,24,25,26)/t18-/m0/s1 |
| InChIKey | DHYJGVYXYOMLHZ-SFHVURJKSA-N |
| XLogP | 6.14 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.42 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|