C26H26Cl2N4O2S — CID 135696211
9-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-2-ethylsulfanyl-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135696211) has the molecular formula C26H26Cl2N4O2S and a molecular weight of 529.49 g/mol. Its IUPAC name is 9-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-2-ethylsulfanyl-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 9-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-2-ethylsulfanyl-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135696211 |
| Molecular Formula | C26H26Cl2N4O2S |
| Molecular Weight | 529.49 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | 9-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-2-ethylsulfanyl-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CCSc1nc2n(n1)C(c1cccc(OCc3ccc(Cl)cc3Cl)c1)C1=C(CC(C)(C)CC1=O)N2 |
| InChI | InChI=1S/C26H26Cl2N4O2S/c1-4-35-25-30-24-29-20-12-26(2,3)13-21(33)22(20)23(32(24)31-25)15-6-5-7-18(10-15)34-14-16-8-9-17(27)11-19(16)28/h5-11,23H,4,12-14H2,1-3H3,(H,29,30,31) |
| InChIKey | RDTZZQVDXPQKBF-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.49 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |