C31H28Cl2N4O2S — CID 135663646
9-[4-[(2-chlorophenyl)methoxy]phenyl]-2-[(2-chlorophenyl)methylsulfanyl]-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135663646) has the molecular formula C31H28Cl2N4O2S and a molecular weight of 591.56 g/mol. Its IUPAC name is 9-[4-[(2-chlorophenyl)methoxy]phenyl]-2-[(2-chlorophenyl)methylsulfanyl]-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 9-[4-[(2-chlorophenyl)methoxy]phenyl]-2-[(2-chlorophenyl)methylsulfanyl]-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135663646 |
| Molecular Formula | C31H28Cl2N4O2S |
| Molecular Weight | 591.56 g/mol |
| Exact Mass | 590.13 |
| IUPAC Name | 9-[4-[(2-chlorophenyl)methoxy]phenyl]-2-[(2-chlorophenyl)methylsulfanyl]-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1nc(SCc3ccccc3Cl)nn1C2c1ccc(OCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C31H28Cl2N4O2S/c1-31(2)15-25-27(26(38)16-31)28(19-11-13-22(14-12-19)39-17-20-7-3-5-9-23(20)32)37-29(34-25)35-30(36-37)40-18-21-8-4-6-10-24(21)33/h3-14,28H,15-18H2,1-2H3,(H,34,35,36) |
| InChIKey | LUTLTDPPBFLWER-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.56 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |