C29H33ClN4O2S — CID 135790119
2-[(2-chlorophenyl)methylsulfanyl]-6,6-dimethyl-9-[4-(3-methylbutoxy)phenyl]-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135790119) has the molecular formula C29H33ClN4O2S and a molecular weight of 537.13 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylsulfanyl]-6,6-dimethyl-9-[4-(3-methylbutoxy)phenyl]-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 2-[(2-chlorophenyl)methylsulfanyl]-6,6-dimethyl-9-[4-(3-methylbutoxy)phenyl]-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135790119 |
| Molecular Formula | C29H33ClN4O2S |
| Molecular Weight | 537.13 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | 2-[(2-chlorophenyl)methylsulfanyl]-6,6-dimethyl-9-[4-(3-methylbutoxy)phenyl]-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CC(C)CCOc1ccc(C2C3=C(CC(C)(C)CC3=O)Nc3nc(SCc4ccccc4Cl)nn32)cc1 |
| InChI | InChI=1S/C29H33ClN4O2S/c1-18(2)13-14-36-21-11-9-19(10-12-21)26-25-23(15-29(3,4)16-24(25)35)31-27-32-28(33-34(26)27)37-17-20-7-5-6-8-22(20)30/h5-12,18,26H,13-17H2,1-4H3,(H,31,32,33) |
| InChIKey | FFXVOMWVNNLKKM-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.13 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |