C24H22Cl2N4OS — CID 136882399
(9R)-9-(4-chlorophenyl)-2-[(2-chlorophenyl)methylsulfanyl]-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 136882399) has the molecular formula C24H22Cl2N4OS and a molecular weight of 485.44 g/mol. Its IUPAC name is (9R)-9-(4-chlorophenyl)-2-[(2-chlorophenyl)methylsulfanyl]-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (9R)-9-(4-chlorophenyl)-2-[(2-chlorophenyl)methylsulfanyl]-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 136882399 |
| Molecular Formula | C24H22Cl2N4OS |
| Molecular Weight | 485.44 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | (9R)-9-(4-chlorophenyl)-2-[(2-chlorophenyl)methylsulfanyl]-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1nc(SCc3ccccc3Cl)nn1[C@@H]2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H22Cl2N4OS/c1-24(2)11-18-20(19(31)12-24)21(14-7-9-16(25)10-8-14)30-22(27-18)28-23(29-30)32-13-15-5-3-4-6-17(15)26/h3-10,21H,11-13H2,1-2H3,(H,27,28,29)/t21-/m1/s1 |
| InChIKey | DOLTTWPFBWJEAR-OAQYLSRUSA-N |
| XLogP | 6.54 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.44 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |