C25H25ClN4O3S — CID 1405452
(9R)-2-[(2-chlorophenyl)methylsulfanyl]-9-(4-hydroxy-3-methoxyphenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 1405452) has the molecular formula C25H25ClN4O3S and a molecular weight of 497.02 g/mol. Its IUPAC name is (9R)-2-[(2-chlorophenyl)methylsulfanyl]-9-(4-hydroxy-3-methoxyphenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (9R)-2-[(2-chlorophenyl)methylsulfanyl]-9-(4-hydroxy-3-methoxyphenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 1405452 |
| Molecular Formula | C25H25ClN4O3S |
| Molecular Weight | 497.02 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | (9R)-2-[(2-chlorophenyl)methylsulfanyl]-9-(4-hydroxy-3-methoxyphenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | COc1cc([C@@H]2C3=C(CC(C)(C)CC3=O)Nc3nc(SCc4ccccc4Cl)nn32)ccc1O |
| InChI | InChI=1S/C25H25ClN4O3S/c1-25(2)11-17-21(19(32)12-25)22(14-8-9-18(31)20(10-14)33-3)30-23(27-17)28-24(29-30)34-13-15-6-4-5-7-16(15)26/h4-10,22,31H,11-13H2,1-3H3,(H,27,28,29)/t22-/m1/s1 |
| InChIKey | IRPDWLKBRCTZDQ-JOCHJYFZSA-N |
| XLogP | 5.60 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.02 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |