C31H37ClN4O3S — CID 135663256
2-[(2-chlorophenyl)methylsulfanyl]-9-(4-hexoxy-3-methoxyphenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135663256) has the molecular formula C31H37ClN4O3S and a molecular weight of 581.18 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylsulfanyl]-9-(4-hexoxy-3-methoxyphenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 2-[(2-chlorophenyl)methylsulfanyl]-9-(4-hexoxy-3-methoxyphenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135663256 |
| Molecular Formula | C31H37ClN4O3S |
| Molecular Weight | 581.18 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | 2-[(2-chlorophenyl)methylsulfanyl]-9-(4-hexoxy-3-methoxyphenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CCCCCCOc1ccc(C2C3=C(CC(C)(C)CC3=O)Nc3nc(SCc4ccccc4Cl)nn32)cc1OC |
| InChI | InChI=1S/C31H37ClN4O3S/c1-5-6-7-10-15-39-25-14-13-20(16-26(25)38-4)28-27-23(17-31(2,3)18-24(27)37)33-29-34-30(35-36(28)29)40-19-21-11-8-9-12-22(21)32/h8-9,11-14,16,28H,5-7,10,15,17-19H2,1-4H3,(H,33,34,35) |
| InChIKey | HDCVZVUNBDFLDV-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.18 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|