C30H34BrClN4O3S — CID 135664068
9-(3-bromo-5-methoxy-4-pentoxyphenyl)-2-[(2-chlorophenyl)methylsulfanyl]-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135664068) has the molecular formula C30H34BrClN4O3S and a molecular weight of 646.05 g/mol. Its IUPAC name is 9-(3-bromo-5-methoxy-4-pentoxyphenyl)-2-[(2-chlorophenyl)methylsulfanyl]-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 9-(3-bromo-5-methoxy-4-pentoxyphenyl)-2-[(2-chlorophenyl)methylsulfanyl]-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135664068 |
| Molecular Formula | C30H34BrClN4O3S |
| Molecular Weight | 646.05 g/mol |
| Exact Mass | 644.12 |
| IUPAC Name | 9-(3-bromo-5-methoxy-4-pentoxyphenyl)-2-[(2-chlorophenyl)methylsulfanyl]-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CCCCCOc1c(Br)cc(C2C3=C(CC(C)(C)CC3=O)Nc3nc(SCc4ccccc4Cl)nn32)cc1OC |
| InChI | InChI=1S/C30H34BrClN4O3S/c1-5-6-9-12-39-27-20(31)13-19(14-24(27)38-4)26-25-22(15-30(2,3)16-23(25)37)33-28-34-29(35-36(26)28)40-17-18-10-7-8-11-21(18)32/h7-8,10-11,13-14,26H,5-6,9,12,15-17H2,1-4H3,(H,33,34,35) |
| InChIKey | QYWYQEUXUFZYRF-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.05 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|