C28H31ClN4O3S — CID 135664766
9-(4-butoxy-3-ethoxyphenyl)-2-[(2-chlorophenyl)methylsulfanyl]-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135664766) has the molecular formula C28H31ClN4O3S and a molecular weight of 539.10 g/mol. Its IUPAC name is 9-(4-butoxy-3-ethoxyphenyl)-2-[(2-chlorophenyl)methylsulfanyl]-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 9-(4-butoxy-3-ethoxyphenyl)-2-[(2-chlorophenyl)methylsulfanyl]-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135664766 |
| Molecular Formula | C28H31ClN4O3S |
| Molecular Weight | 539.10 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | 9-(4-butoxy-3-ethoxyphenyl)-2-[(2-chlorophenyl)methylsulfanyl]-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CCCCOc1ccc(C2C3=C(CCCC3=O)Nc3nc(SCc4ccccc4Cl)nn32)cc1OCC |
| InChI | InChI=1S/C28H31ClN4O3S/c1-3-5-15-36-23-14-13-18(16-24(23)35-4-2)26-25-21(11-8-12-22(25)34)30-27-31-28(32-33(26)27)37-17-19-9-6-7-10-20(19)29/h6-7,9-10,13-14,16,26H,3-5,8,11-12,15,17H2,1-2H3,(H,30,31,32) |
| InChIKey | CYBVJIJDTYPOID-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.10 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|