C28H32N4O3S — CID 136806968
(9R)-9-(3,4-dimethoxyphenyl)-2-[(2,5-dimethylphenyl)methylsulfanyl]-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 136806968) has the molecular formula C28H32N4O3S and a molecular weight of 504.66 g/mol. Its IUPAC name is (9R)-9-(3,4-dimethoxyphenyl)-2-[(2,5-dimethylphenyl)methylsulfanyl]-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (9R)-9-(3,4-dimethoxyphenyl)-2-[(2,5-dimethylphenyl)methylsulfanyl]-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 136806968 |
| Molecular Formula | C28H32N4O3S |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | (9R)-9-(3,4-dimethoxyphenyl)-2-[(2,5-dimethylphenyl)methylsulfanyl]-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | COc1ccc([C@@H]2C3=C(CC(C)(C)CC3=O)Nc3nc(SCc4cc(C)ccc4C)nn32)cc1OC |
| InChI | InChI=1S/C28H32N4O3S/c1-16-7-8-17(2)19(11-16)15-36-27-30-26-29-20-13-28(3,4)14-21(33)24(20)25(32(26)31-27)18-9-10-22(34-5)23(12-18)35-6/h7-12,25H,13-15H2,1-6H3,(H,29,30,31)/t25-/m1/s1 |
| InChIKey | KRXRGBMQJWBUKL-RUZDIDTESA-N |
| XLogP | 5.86 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |