C28H30N4O5S — CID 136720272
(9R)-9-(3,4-dimethoxyphenyl)-2-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 136720272) has the molecular formula C28H30N4O5S and a molecular weight of 534.64 g/mol. Its IUPAC name is (9R)-9-(3,4-dimethoxyphenyl)-2-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (9R)-9-(3,4-dimethoxyphenyl)-2-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 136720272 |
| Molecular Formula | C28H30N4O5S |
| Molecular Weight | 534.64 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | (9R)-9-(3,4-dimethoxyphenyl)-2-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | COc1ccc(C(=O)CSc2nc3n(n2)[C@H](c2ccc(OC)c(OC)c2)C2=C(CC(C)(C)CC2=O)N3)cc1 |
| InChI | InChI=1S/C28H30N4O5S/c1-28(2)13-19-24(20(33)14-28)25(17-8-11-22(36-4)23(12-17)37-5)32-26(29-19)30-27(31-32)38-15-21(34)16-6-9-18(35-3)10-7-16/h6-12,25H,13-15H2,1-5H3,(H,29,30,31)/t25-/m1/s1 |
| InChIKey | YNWSHDIFCVVEKS-RUZDIDTESA-N |
| XLogP | 4.94 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.64 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |