C26H25N5O5S — CID 136807028
(9R)-2-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl-6,6-dimethyl-9-(3-nitrophenyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 136807028) has the molecular formula C26H25N5O5S and a molecular weight of 519.58 g/mol. Its IUPAC name is (9R)-2-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl-6,6-dimethyl-9-(3-nitrophenyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (9R)-2-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl-6,6-dimethyl-9-(3-nitrophenyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 136807028 |
| Molecular Formula | C26H25N5O5S |
| Molecular Weight | 519.58 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | (9R)-2-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl-6,6-dimethyl-9-(3-nitrophenyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | COc1ccc(C(=O)CSc2nc3n(n2)[C@H](c2cccc([N+](=O)[O-])c2)C2=C(CC(C)(C)CC2=O)N3)cc1 |
| InChI | InChI=1S/C26H25N5O5S/c1-26(2)12-19-22(20(32)13-26)23(16-5-4-6-17(11-16)31(34)35)30-24(27-19)28-25(29-30)37-14-21(33)15-7-9-18(36-3)10-8-15/h4-11,23H,12-14H2,1-3H3,(H,27,28,29)/t23-/m1/s1 |
| InChIKey | FSBBWTXESSQPAS-HSZRJFAPSA-N |
| XLogP | 4.83 |
| TPSA | 129.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.58 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|