C25H22ClFN4O2S — CID 136806845
(9S)-9-(3-chlorophenyl)-2-[2-(4-fluorophenyl)-2-oxoethyl]sulfanyl-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 136806845) has the molecular formula C25H22ClFN4O2S and a molecular weight of 497.00 g/mol. Its IUPAC name is (9S)-9-(3-chlorophenyl)-2-[2-(4-fluorophenyl)-2-oxoethyl]sulfanyl-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (9S)-9-(3-chlorophenyl)-2-[2-(4-fluorophenyl)-2-oxoethyl]sulfanyl-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 136806845 |
| Molecular Formula | C25H22ClFN4O2S |
| Molecular Weight | 497.00 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | (9S)-9-(3-chlorophenyl)-2-[2-(4-fluorophenyl)-2-oxoethyl]sulfanyl-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1nc(SCC(=O)c3ccc(F)cc3)nn1[C@H]2c1cccc(Cl)c1 |
| InChI | InChI=1S/C25H22ClFN4O2S/c1-25(2)11-18-21(19(32)12-25)22(15-4-3-5-16(26)10-15)31-23(28-18)29-24(30-31)34-13-20(33)14-6-8-17(27)9-7-14/h3-10,22H,11-13H2,1-2H3,(H,28,29,30)/t22-/m0/s1 |
| InChIKey | WHGXWRYZYLVJCL-QFIPXVFZSA-N |
| XLogP | 5.70 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.00 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |