C27H30N4OS — CID 136806990
(9R)-2-[(2,4-dimethylphenyl)methylsulfanyl]-6,6-dimethyl-9-(4-methylphenyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 136806990) has the molecular formula C27H30N4OS and a molecular weight of 458.63 g/mol. Its IUPAC name is (9R)-2-[(2,4-dimethylphenyl)methylsulfanyl]-6,6-dimethyl-9-(4-methylphenyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (9R)-2-[(2,4-dimethylphenyl)methylsulfanyl]-6,6-dimethyl-9-(4-methylphenyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 136806990 |
| Molecular Formula | C27H30N4OS |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | (9R)-2-[(2,4-dimethylphenyl)methylsulfanyl]-6,6-dimethyl-9-(4-methylphenyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | Cc1ccc([C@@H]2C3=C(CC(C)(C)CC3=O)Nc3nc(SCc4ccc(C)cc4C)nn32)cc1 |
| InChI | InChI=1S/C27H30N4OS/c1-16-6-9-19(10-7-16)24-23-21(13-27(4,5)14-22(23)32)28-25-29-26(30-31(24)25)33-15-20-11-8-17(2)12-18(20)3/h6-12,24H,13-15H2,1-5H3,(H,28,29,30)/t24-/m1/s1 |
| InChIKey | RTWLMCJVBXHMJC-XMMPIXPASA-N |
| XLogP | 6.15 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |