C26H27ClN4OS — CID 136806997
(9R)-9-(2-chlorophenyl)-2-[(2,4-dimethylphenyl)methylsulfanyl]-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 136806997) has the molecular formula C26H27ClN4OS and a molecular weight of 479.05 g/mol. Its IUPAC name is (9R)-9-(2-chlorophenyl)-2-[(2,4-dimethylphenyl)methylsulfanyl]-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (9R)-9-(2-chlorophenyl)-2-[(2,4-dimethylphenyl)methylsulfanyl]-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 136806997 |
| Molecular Formula | C26H27ClN4OS |
| Molecular Weight | 479.05 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | (9R)-9-(2-chlorophenyl)-2-[(2,4-dimethylphenyl)methylsulfanyl]-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | Cc1ccc(CSc2nc3n(n2)[C@@H](c2ccccc2Cl)C2=C(CC(C)(C)CC2=O)N3)c(C)c1 |
| InChI | InChI=1S/C26H27ClN4OS/c1-15-9-10-17(16(2)11-15)14-33-25-29-24-28-20-12-26(3,4)13-21(32)22(20)23(31(24)30-25)18-7-5-6-8-19(18)27/h5-11,23H,12-14H2,1-4H3,(H,28,29,30)/t23-/m0/s1 |
| InChIKey | XPIBVOHMMYIYSQ-QHCPKHFHSA-N |
| XLogP | 6.50 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.05 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |