C32H32N4O2S — CID 135793729
2-benzylsulfanyl-6,6-dimethyl-9-[3-[(4-methylphenyl)methoxy]phenyl]-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135793729) has the molecular formula C32H32N4O2S and a molecular weight of 536.70 g/mol. Its IUPAC name is 2-benzylsulfanyl-6,6-dimethyl-9-[3-[(4-methylphenyl)methoxy]phenyl]-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 2-benzylsulfanyl-6,6-dimethyl-9-[3-[(4-methylphenyl)methoxy]phenyl]-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135793729 |
| Molecular Formula | C32H32N4O2S |
| Molecular Weight | 536.70 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | 2-benzylsulfanyl-6,6-dimethyl-9-[3-[(4-methylphenyl)methoxy]phenyl]-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | Cc1ccc(COc2cccc(C3C4=C(CC(C)(C)CC4=O)Nc4nc(SCc5ccccc5)nn43)c2)cc1 |
| InChI | InChI=1S/C32H32N4O2S/c1-21-12-14-22(15-13-21)19-38-25-11-7-10-24(16-25)29-28-26(17-32(2,3)18-27(28)37)33-30-34-31(35-36(29)30)39-20-23-8-5-4-6-9-23/h4-16,29H,17-20H2,1-3H3,(H,33,34,35) |
| InChIKey | QPHOFWMJBUIQNV-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.70 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |