C26H28N4O2S — CID 135693963
2-butylsulfanyl-9-(3-phenylmethoxyphenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135693963) has the molecular formula C26H28N4O2S and a molecular weight of 460.60 g/mol. Its IUPAC name is 2-butylsulfanyl-9-(3-phenylmethoxyphenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 2-butylsulfanyl-9-(3-phenylmethoxyphenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135693963 |
| Molecular Formula | C26H28N4O2S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 2-butylsulfanyl-9-(3-phenylmethoxyphenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CCCCSc1nc2n(n1)C(c1cccc(OCc3ccccc3)c1)C1=C(CCCC1=O)N2 |
| InChI | InChI=1S/C26H28N4O2S/c1-2-3-15-33-26-28-25-27-21-13-8-14-22(31)23(21)24(30(25)29-26)19-11-7-12-20(16-19)32-17-18-9-5-4-6-10-18/h4-7,9-12,16,24H,2-3,8,13-15,17H2,1H3,(H,27,28,29) |
| InChIKey | QLNFZFNYVNCNLU-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|